| dbo:wikiPageID
| |
| dbo:wikiPageLength
|
- 78616 (xsd:nonNegativeInteger)
|
| dbo:wikiPageRevisionID
| |
| prop-el:addictionLiability
| |
| prop-el:atcPrefix
| |
| prop-el:atcSuffix
| |
| prop-el:atcSupplemental
| |
| prop-el:bioavailability
|
- (el)
- By mouth: 33% (el)
- Nasal spray: 25–43% (el)
- insufflated: 60–80% (el)
- (el)
- By mouth: 33% (el)
- Nasal spray: 25–43% (el)
- insufflated: 60–80% (el)
|
| prop-el:boilingPoint
| |
| prop-el:c
| |
| prop-el:casNumber
| |
| prop-el:chebi
| |
| prop-el:chembl
| |
| prop-el:chemspiderid
| |
| prop-el:dailymedid
|
- Cocaine (el)
- Cocaine (el)
|
| prop-el:dependencyLiability
| |
| prop-el:drugbank
|
- DB00907 (el)
- DB00907 (el)
|
| prop-el:durationOfAction
| |
| prop-el:excretion
| |
| prop-el:image
|
- Cocaine-from-xtal-1983-3D-balls.png (el)
- Kokain - Cocaine.svg (el)
- Cocaine-from-xtal-1983-3D-balls.png (el)
- Kokain - Cocaine.svg (el)
|
| prop-el:iupacName
|
- Methyl -3--8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (el)
- Methyl -3--8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (el)
|
| prop-el:iupharLigand
| |
| prop-el:kegg
| |
| prop-el:legalAu
|
- Παράρτημα 8 (el)
- Παράρτημα 8 (el)
|
| prop-el:legalCa
|
- Παράρτημα I (el)
- Παράρτημα I (el)
|
| prop-el:legalDe
|
- Anlage III (el)
- Anlage III (el)
|
| prop-el:legalNz
| |
| prop-el:legalUk
| |
| prop-el:legalUn
|
- N I III (el)
- N I III (el)
|
| prop-el:legalUs
|
- Παράρτημα II (el)
- Παράρτημα II (el)
|
| prop-el:meltingPoint
| |
| prop-el:metabolism
| |
| prop-el:metabolites
|
- Νορκοκαΐνη, βενζοϊλεκγονίνη, κοκααιθυλένιο (el)
- Νορκοκαΐνη, βενζοϊλεκγονίνη, κοκααιθυλένιο (el)
|
| prop-el:molecularWeight
| |
| prop-el:n
| |
| prop-el:onset
|
- Δευτερόλεπτα με λεπτά (el)
- Δευτερόλεπτα με λεπτά (el)
|
| prop-el:pdbLigand
| |
| prop-el:pregnancyUs
| |
| prop-el:pubchem
| |
| prop-el:routesOfAdministration
|
- Τοπικά, από το στόμα, ενδοφλεβίως, ενδορινικά (el)
- Τοπικά, από το στόμα, ενδοφλεβίως, ενδορινικά (el)
|
| prop-el:smiles
|
- CN1[C@H]2CC[C@@H]1[C@@H][C@@H]C2 (el)
- CN1[C@H]2CC[C@@H]1[C@@H][C@@H]C2 (el)
|
| prop-el:solubility
| |
| prop-el:stdinchi
| |
| prop-el:stdinchikey
|
- ZPUCINDJVBIVPJ-LJISPDSOSA-N (el)
- ZPUCINDJVBIVPJ-LJISPDSOSA-N (el)
|
| prop-el:synonyms
|
- βενζοϋλομεθυλεκγονίνη, κόκα, κρακ (el)
- βενζοϋλομεθυλεκγονίνη, κόκα, κρακ (el)
|
| prop-el:tradename
|
- Neurocaine, Goprelto, Numbrino, άλλες (el)
- Neurocaine, Goprelto, Numbrino, άλλες (el)
|
| prop-el:unii
|
- I5Y540LHVR (el)
- I5Y540LHVR (el)
|
| prop-el:verifiedrevid
| |
| prop-el:wikiPageUsesTemplate
| |
| prop-el:η
| |
| prop-el:ο
| |
| dct:subject
| |
| rdfs:label
|
- Κοκαΐνη (el)
- Κοκαΐνη (el)
|
| owl:sameAs
| |
| prov:wasDerivedFrom
| |
| foaf:isPrimaryTopicOf
| |
| is dbo:wikiPageRedirects
of | |
| is foaf:primaryTopic
of | |
